C17H20F2IN3O — CID 111806139
2-[2-(3,4-difluorophenoxy)ethyl]-1-(4-ethylphenyl)guanidine;hydroiodide (PubChem CID 111806139) has the molecular formula C17H20F2IN3O and a molecular weight of 447.27 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenoxy)ethyl]-1-(4-ethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[2-(3,4-difluorophenoxy)ethyl]-1-(4-ethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111806139 |
| Molecular Formula | C17H20F2IN3O |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 2-[2-(3,4-difluorophenoxy)ethyl]-1-(4-ethylphenyl)guanidine;hydroiodide |
| SMILES | CCc1ccc(N/C(N)=N/CCOc2ccc(F)c(F)c2)cc1.I |
| InChI | InChI=1S/C17H19F2N3O.HI/c1-2-12-3-5-13(6-4-12)22-17(20)21-9-10-23-14-7-8-15(18)16(19)11-14;/h3-8,11H,2,9-10H2,1H3,(H3,20,21,22);1H |
| InChIKey | VVSUGJZMMPZNQZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|