C15H21F3N2O3 — CID 111578878
3-(2,6-dimethylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 111578878) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 3-(2,6-dimethylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 111578878 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | Cc1cccc(C)c1NC(=O)N(CCO)CCOCC(F)(F)F |
| InChI | InChI=1S/C15H21F3N2O3/c1-11-4-3-5-12(2)13(11)19-14(22)20(6-8-21)7-9-23-10-15(16,17)18/h3-5,21H,6-10H2,1-2H3,(H,19,22) |
| InChIKey | VVEBWOPNBVMAJQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|