C14H18F4N2O3 — CID 111578872
3-(2-fluoro-5-methylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea (PubChem CID 111578872) has the molecular formula C14H18F4N2O3 and a molecular weight of 338.30 g/mol. Its IUPAC name is 3-(2-fluoro-5-methylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea.
| Compound Name | 3-(2-fluoro-5-methylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
|---|---|
| PubChem CID | 111578872 |
| Molecular Formula | C14H18F4N2O3 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3-(2-fluoro-5-methylphenyl)-1-(2-hydroxyethyl)-1-[2-(2,2,2-trifluoroethoxy)ethyl]urea |
| SMILES | Cc1ccc(F)c(NC(=O)N(CCO)CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F4N2O3/c1-10-2-3-11(15)12(8-10)19-13(22)20(4-6-21)5-7-23-9-14(16,17)18/h2-3,8,21H,4-7,9H2,1H3,(H,19,22) |
| InChIKey | NFDWDEFKRAMOQF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|