C17H18F3N3O3 — CID 71912891
N-(2-hydroxyethyl)-2-phenyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxamide (PubChem CID 71912891) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-phenyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-phenyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 71912891 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-(2-hydroxyethyl)-2-phenyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]pyrimidine-5-carboxamide |
| SMILES | O=C(c1cnc(-c2ccccc2)nc1)N(CCO)CCOCC(F)(F)F |
| InChI | InChI=1S/C17H18F3N3O3/c18-17(19,20)12-26-9-7-23(6-8-24)16(25)14-10-21-15(22-11-14)13-4-2-1-3-5-13/h1-5,10-11,24H,6-9,12H2 |
| InChIKey | GMGFSLWQEMJABE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|