C23H17ClF6N2O2 — CID 18387224
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-chloro-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide (PubChem CID 18387224) has the molecular formula C23H17ClF6N2O2 and a molecular weight of 502.84 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-chloro-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-chloro-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 18387224 |
| Molecular Formula | C23H17ClF6N2O2 |
| Molecular Weight | 502.84 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-chloro-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide |
| SMILES | O=C(c1c(-c2ccccc2)ccnc1Cl)N(CCO)Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H17ClF6N2O2/c24-20-19(18(6-7-31-20)15-4-2-1-3-5-15)21(34)32(8-9-33)13-14-10-16(22(25,26)27)12-17(11-14)23(28,29)30/h1-7,10-12,33H,8-9,13H2 |
| InChIKey | QAPGCKSLMOYEGM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.84 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|