C21H17Cl3N2O2 — CID 18387334
2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide (PubChem CID 18387334) has the molecular formula C21H17Cl3N2O2 and a molecular weight of 435.74 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 18387334 |
| Molecular Formula | C21H17Cl3N2O2 |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-(2-hydroxyethyl)-4-phenylpyridine-3-carboxamide |
| SMILES | O=C(c1c(-c2ccccc2)ccnc1Cl)N(CCO)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl3N2O2/c22-17-7-6-14(12-18(17)23)13-26(10-11-27)21(28)19-16(8-9-25-20(19)24)15-4-2-1-3-5-15/h1-9,12,27H,10-11,13H2 |
| InChIKey | ZJMAPWGPEXQQLX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|