C16H25N3O4 — CID 48744646
3-[bis(2-methoxyethyl)carbamoylamino]-N,N-dimethylbenzamide (PubChem CID 48744646) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[bis(2-methoxyethyl)carbamoylamino]-N,N-dimethylbenzamide.
| Compound Name | 3-[bis(2-methoxyethyl)carbamoylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 48744646 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 3-[bis(2-methoxyethyl)carbamoylamino]-N,N-dimethylbenzamide |
| SMILES | COCCN(CCOC)C(=O)Nc1cccc(C(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H25N3O4/c1-18(2)15(20)13-6-5-7-14(12-13)17-16(21)19(8-10-22-3)9-11-23-4/h5-7,12H,8-11H2,1-4H3,(H,17,21) |
| InChIKey | ADKUIYFJPZEVGC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |