C21H33N3O — CID 135120037
N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-[benzyl(methyl)amino]-N-methylacetamide (PubChem CID 135120037) has the molecular formula C21H33N3O and a molecular weight of 343.51 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-[benzyl(methyl)amino]-N-methylacetamide.
| Compound Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-[benzyl(methyl)amino]-N-methylacetamide |
|---|---|
| PubChem CID | 135120037 |
| Molecular Formula | C21H33N3O |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.26 |
| IUPAC Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-[benzyl(methyl)amino]-N-methylacetamide |
| SMILES | CN(CC(=O)N(C)C1C[C@H]2CC(N(C)C)C[C@H]2C1)Cc1ccccc1 |
| InChI | InChI=1S/C21H33N3O/c1-22(2)19-10-17-12-20(13-18(17)11-19)24(4)21(25)15-23(3)14-16-8-6-5-7-9-16/h5-9,17-20H,10-15H2,1-4H3/t17-,18+,19?,20? |
| InChIKey | SPUVEQJYEISZDM-VCWRXUFXSA-N |
| XLogP | 2.70 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |