C20H30N2O2 — CID 134706575
N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(4-hydroxyphenyl)-N-methylpropanamide (PubChem CID 134706575) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(4-hydroxyphenyl)-N-methylpropanamide.
| Compound Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(4-hydroxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 134706575 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-3-(4-hydroxyphenyl)-N-methylpropanamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)CCc3ccc(O)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C20H30N2O2/c1-21(2)17-10-15-12-18(13-16(15)11-17)22(3)20(24)9-6-14-4-7-19(23)8-5-14/h4-5,7-8,15-18,23H,6,9-13H2,1-3H3/t15-,16+,17?,18? |
| InChIKey | UEIXANVOAPTWJZ-OQSMONGASA-N |
| XLogP | 2.90 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |