C24H38N2O2 — CID 134700087
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(4-ethoxy-3-methylphenyl)-N-methylbutanamide (PubChem CID 134700087) has the molecular formula C24H38N2O2 and a molecular weight of 386.58 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(4-ethoxy-3-methylphenyl)-N-methylbutanamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(4-ethoxy-3-methylphenyl)-N-methylbutanamide |
|---|---|
| PubChem CID | 134700087 |
| Molecular Formula | C24H38N2O2 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(4-ethoxy-3-methylphenyl)-N-methylbutanamide |
| SMILES | CCOc1ccc(CCCC(=O)N(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)cc1C |
| InChI | InChI=1S/C24H38N2O2/c1-6-28-23-11-10-18(12-17(23)2)8-7-9-24(27)26(5)22-15-19-13-21(25(3)4)14-20(19)16-22/h10-12,19-22H,6-9,13-16H2,1-5H3/t19-,20+,21?,22? |
| InChIKey | FGFXDWNBYLCNQV-FDRBHKFBSA-N |
| XLogP | 4.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |