C23H33N3O2 — CID 134699293
N-[4-[2-[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-2-oxoethyl]phenyl]cyclopropanecarboxamide (PubChem CID 134699293) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[4-[2-[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-2-oxoethyl]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[2-[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-2-oxoethyl]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 134699293 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-[4-[2-[[(3aR,6aS)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-methylamino]-2-oxoethyl]phenyl]cyclopropanecarboxamide |
| SMILES | CN(C)C1C[C@@H]2CC(N(C)C(=O)Cc3ccc(NC(=O)C4CC4)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C23H33N3O2/c1-25(2)20-11-17-13-21(14-18(17)12-20)26(3)22(27)10-15-4-8-19(9-5-15)24-23(28)16-6-7-16/h4-5,8-9,16-18,20-21H,6-7,10-14H2,1-3H3,(H,24,28)/t17-,18+,20?,21? |
| InChIKey | JWBTYUZHTNWQDH-FWGXRIOKSA-N |
| XLogP | 3.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |