About cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel
cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel (PubChem CID 57373064) has the molecular formula C18H28NiO4S
and a molecular weight of 399.18 g/mol. Its IUPAC name is cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel.
Molecular Properties
| Compound Name | cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel |
| PubChem CID | 57373064 |
| Molecular Formula | C18H28NiO4S |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel |
| SMILES | C1CCCCCCC1.COC(=O)CCS(=O)(=O)c1ccccc1.[Ni] |
| InChI | InChI=1S/C10H12O4S.C8H16.Ni/c1-14-10(11)7-8-15(12,13)9-5-3-2-4-6-9;1-2-4-6-8-7-5-3-1;/h2-6H,7-8H2,1H3;1-8H2; |
| InChIKey | CIVNQHDUKKHMTP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel?
The IUPAC name of cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel (CID 57373064) is cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel.
What is the SMILES notation for cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel?
The canonical SMILES for cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel is C1CCCCCCC1.COC(=O)CCS(=O)(=O)c1ccccc1.[Ni].
What is the InChIKey of cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel?
The InChIKey is CIVNQHDUKKHMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4S.C8H16.Ni/c1-14-10(11)7-8-15(12,13)9-5-3-2-4-6-9;1-2-4-6-8-7-5-3-1;/h2-6H,7-8H2,1H3;1-8H2;.
What are the key properties of cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel?
cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel has a molecular weight of 399.18 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclooctane;methyl 3-(benzenesulfonyl)propanoate;nickel is sourced from PubChem (CID 57373064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).