C12H16BrNO4S — CID 55096547
2-[2-(4-bromophenyl)sulfonylethyl-methylamino]propanoic acid (PubChem CID 55096547) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfonylethyl-methylamino]propanoic acid.
| Compound Name | 2-[2-(4-bromophenyl)sulfonylethyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 55096547 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfonylethyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CCS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H16BrNO4S/c1-9(12(15)16)14(2)7-8-19(17,18)11-5-3-10(13)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | KNRGLRVZQJLRKC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |