C18H23NO3S — CID 11256082
(1R,2S)-2-[2-(benzenesulfonyl)ethyl-methylamino]-1-phenylpropan-1-ol (PubChem CID 11256082) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (1R,2S)-2-[2-(benzenesulfonyl)ethyl-methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[2-(benzenesulfonyl)ethyl-methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 11256082 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (1R,2S)-2-[2-(benzenesulfonyl)ethyl-methylamino]-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H23NO3S/c1-15(18(20)16-9-5-3-6-10-16)19(2)13-14-23(21,22)17-11-7-4-8-12-17/h3-12,15,18,20H,13-14H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | BPIPFRXNBLKHML-YJBOKZPZSA-N |
| XLogP | 2.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |