C15H25ClN2O5S — CID 119497210
N-(3-aminobutyl)-3-(3,4-dimethoxyphenyl)sulfonylpropanamide;hydrochloride (PubChem CID 119497210) has the molecular formula C15H25ClN2O5S and a molecular weight of 380.89 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(3,4-dimethoxyphenyl)sulfonylpropanamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-3-(3,4-dimethoxyphenyl)sulfonylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119497210 |
| Molecular Formula | C15H25ClN2O5S |
| Molecular Weight | 380.89 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(3-aminobutyl)-3-(3,4-dimethoxyphenyl)sulfonylpropanamide;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)CCC(=O)NCCC(C)N)cc1OC.Cl |
| InChI | InChI=1S/C15H24N2O5S.ClH/c1-11(16)6-8-17-15(18)7-9-23(19,20)12-4-5-13(21-2)14(10-12)22-3;/h4-5,10-11H,6-9,16H2,1-3H3,(H,17,18);1H |
| InChIKey | KNXQMDROKCEGIX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.89 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |