C8H17F3N2O2S — CID 112689923
3-[propyl(2,2,2-trifluoroethyl)amino]propane-1-sulfonamide (PubChem CID 112689923) has the molecular formula C8H17F3N2O2S and a molecular weight of 262.30 g/mol. Its IUPAC name is 3-[propyl(2,2,2-trifluoroethyl)amino]propane-1-sulfonamide.
| Compound Name | 3-[propyl(2,2,2-trifluoroethyl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112689923 |
| Molecular Formula | C8H17F3N2O2S |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[propyl(2,2,2-trifluoroethyl)amino]propane-1-sulfonamide |
| SMILES | CCCN(CCCS(N)(=O)=O)CC(F)(F)F |
| InChI | InChI=1S/C8H17F3N2O2S/c1-2-4-13(7-8(9,10)11)5-3-6-16(12,14)15/h2-7H2,1H3,(H2,12,14,15) |
| InChIKey | IMHVXSFRYXARLT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |