C9H22N2O2S — CID 112691055
3-[methyl(2-methylbutan-2-yl)amino]propane-1-sulfonamide (PubChem CID 112691055) has the molecular formula C9H22N2O2S and a molecular weight of 222.35 g/mol. Its IUPAC name is 3-[methyl(2-methylbutan-2-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[methyl(2-methylbutan-2-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112691055 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-[methyl(2-methylbutan-2-yl)amino]propane-1-sulfonamide |
| SMILES | CCC(C)(C)N(C)CCCS(N)(=O)=O |
| InChI | InChI=1S/C9H22N2O2S/c1-5-9(2,3)11(4)7-6-8-14(10,12)13/h5-8H2,1-4H3,(H2,10,12,13) |
| InChIKey | CIKLIUWZWABSJO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |