C9H22N2O2S2 — CID 112551530
3-[methyl(1-methylsulfanylbutan-2-yl)amino]propane-1-sulfonamide (PubChem CID 112551530) has the molecular formula C9H22N2O2S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-[methyl(1-methylsulfanylbutan-2-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[methyl(1-methylsulfanylbutan-2-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 112551530 |
| Molecular Formula | C9H22N2O2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[methyl(1-methylsulfanylbutan-2-yl)amino]propane-1-sulfonamide |
| SMILES | CCC(CSC)N(C)CCCS(N)(=O)=O |
| InChI | InChI=1S/C9H22N2O2S2/c1-4-9(8-14-3)11(2)6-5-7-15(10,12)13/h9H,4-8H2,1-3H3,(H2,10,12,13) |
| InChIKey | XNQBLUHUSIPHDD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |