C12H29N3O2S2 — CID 112667380
N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]propane-1,3-diamine (PubChem CID 112667380) has the molecular formula C12H29N3O2S2 and a molecular weight of 311.52 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 112667380 |
| Molecular Formula | C12H29N3O2S2 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]propane-1,3-diamine |
| SMILES | CCNCCCN(C)S(=O)(=O)N(C)C(CC)CSC |
| InChI | InChI=1S/C12H29N3O2S2/c1-6-12(11-18-5)15(4)19(16,17)14(3)10-8-9-13-7-2/h12-13H,6-11H2,1-5H3 |
| InChIKey | OZUOUGBAHQHLFK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|