C13H32N4O2S — CID 102998612
N'-[3-(dimethylamino)propyl-ethylsulfamoyl]-N-ethyl-N'-methylpropane-1,3-diamine (PubChem CID 102998612) has the molecular formula C13H32N4O2S and a molecular weight of 308.49 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl-ethylsulfamoyl]-N-ethyl-N'-methylpropane-1,3-diamine.
| Compound Name | N'-[3-(dimethylamino)propyl-ethylsulfamoyl]-N-ethyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102998612 |
| Molecular Formula | C13H32N4O2S |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | N'-[3-(dimethylamino)propyl-ethylsulfamoyl]-N-ethyl-N'-methylpropane-1,3-diamine |
| SMILES | CCNCCCN(C)S(=O)(=O)N(CC)CCCN(C)C |
| InChI | InChI=1S/C13H32N4O2S/c1-6-14-10-8-12-16(5)20(18,19)17(7-2)13-9-11-15(3)4/h14H,6-13H2,1-5H3 |
| InChIKey | JIKWWTPXUCWCMC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|