C11H27N3O2S2 — CID 112667469
N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]propane-1,3-diamine (PubChem CID 112667469) has the molecular formula C11H27N3O2S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 112667469 |
| Molecular Formula | C11H27N3O2S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]propane-1,3-diamine |
| SMILES | CCNCCCN(C)S(=O)(=O)N(C)C(C)CSC |
| InChI | InChI=1S/C11H27N3O2S2/c1-6-12-8-7-9-13(3)18(15,16)14(4)11(2)10-17-5/h11-12H,6-10H2,1-5H3 |
| InChIKey | YTSRDNIMQKJUAP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|