C9H21NO3S2 — CID 112666974
1-hydroxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)propane-2-sulfonamide (PubChem CID 112666974) has the molecular formula C9H21NO3S2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 1-hydroxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)propane-2-sulfonamide.
| Compound Name | 1-hydroxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 112666974 |
| Molecular Formula | C9H21NO3S2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-hydroxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)propane-2-sulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)C(C)CO |
| InChI | InChI=1S/C9H21NO3S2/c1-5-9(7-14-4)10(3)15(12,13)8(2)6-11/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | LFRDBBZZIIZSAI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |