C11H19NO3S3 — CID 112666962
5-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-sulfonamide (PubChem CID 112666962) has the molecular formula C11H19NO3S3 and a molecular weight of 309.48 g/mol. Its IUPAC name is 5-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112666962 |
| Molecular Formula | C11H19NO3S3 |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 5-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-sulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1ccc(CO)s1 |
| InChI | InChI=1S/C11H19NO3S3/c1-4-9(8-16-3)12(2)18(14,15)11-6-5-10(7-13)17-11/h5-6,9,13H,4,7-8H2,1-3H3 |
| InChIKey | PAGZXJKDRNZRFM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |