C14H23NO4S2 — CID 115988140
5-(hydroxymethyl)-2-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 115988140) has the molecular formula C14H23NO4S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115988140 |
| Molecular Formula | C14H23NO4S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 5-(hydroxymethyl)-2-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1cc(CO)ccc1OC |
| InChI | InChI=1S/C14H23NO4S2/c1-5-12(10-20-4)15(2)21(17,18)14-8-11(9-16)6-7-13(14)19-3/h6-8,12,16H,5,9-10H2,1-4H3 |
| InChIKey | QIXCFOPGXAOHSF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |