C13H20BrNO3S2 — CID 115897747
3-bromo-4-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 115897747) has the molecular formula C13H20BrNO3S2 and a molecular weight of 382.35 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115897747 |
| Molecular Formula | C13H20BrNO3S2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 3-bromo-4-methoxy-N-methyl-N-(1-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C13H20BrNO3S2/c1-5-10(9-19-4)15(2)20(16,17)11-6-7-13(18-3)12(14)8-11/h6-8,10H,5,9H2,1-4H3 |
| InChIKey | FXDOUJBXCSCEMB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |