C10H22ClNO2S2 — CID 112663369
3-chloro-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)propane-1-sulfonamide (PubChem CID 112663369) has the molecular formula C10H22ClNO2S2 and a molecular weight of 287.88 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)propane-1-sulfonamide.
| Compound Name | 3-chloro-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 112663369 |
| Molecular Formula | C10H22ClNO2S2 |
| Molecular Weight | 287.88 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-(1-methylsulfanylbutan-2-yl)propane-1-sulfonamide |
| SMILES | CCC(CSC)N(C)S(=O)(=O)CC(C)CCl |
| InChI | InChI=1S/C10H22ClNO2S2/c1-5-10(7-15-4)12(3)16(13,14)8-9(2)6-11/h9-10H,5-8H2,1-4H3 |
| InChIKey | RAFNCWJOJWTLLL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.88 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|