C12H24N2O4S2 — CID 115985522
1-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]piperidine-4-carboxylic acid (PubChem CID 115985522) has the molecular formula C12H24N2O4S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 115985522 |
| Molecular Formula | C12H24N2O4S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[methyl(1-methylsulfanylbutan-2-yl)sulfamoyl]piperidine-4-carboxylic acid |
| SMILES | CCC(CSC)N(C)S(=O)(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H24N2O4S2/c1-4-11(9-19-3)13(2)20(17,18)14-7-5-10(6-8-14)12(15)16/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | CRPBRIQSHVPLII-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |