C11H22N2O4S2 — CID 112658011
1-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]piperidine-3-carboxylic acid (PubChem CID 112658011) has the molecular formula C11H22N2O4S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 112658011 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[methyl(1-methylsulfanylpropan-2-yl)sulfamoyl]piperidine-3-carboxylic acid |
| SMILES | CSCC(C)N(C)S(=O)(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C11H22N2O4S2/c1-9(8-18-3)12(2)19(16,17)13-6-4-5-10(7-13)11(14)15/h9-10H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | BHXXJVIKLSXHNJ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |