C12H24N2O4S — CID 60857619
1-[butan-2-yl(ethyl)sulfamoyl]piperidine-3-carboxylic acid (PubChem CID 60857619) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-[butan-2-yl(ethyl)sulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[butan-2-yl(ethyl)sulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 60857619 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[butan-2-yl(ethyl)sulfamoyl]piperidine-3-carboxylic acid |
| SMILES | CCC(C)N(CC)S(=O)(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C12H24N2O4S/c1-4-10(3)14(5-2)19(17,18)13-8-6-7-11(9-13)12(15)16/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | KIGRTAGWGSRPLQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |