C11H24N2O3S2 — CID 112667005
2-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)piperidine-1-sulfonamide (PubChem CID 112667005) has the molecular formula C11H24N2O3S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)piperidine-1-sulfonamide.
| Compound Name | 2-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 112667005 |
| Molecular Formula | C11H24N2O3S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-(hydroxymethyl)-N-methyl-N-(1-methylsulfanylpropan-2-yl)piperidine-1-sulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)N1CCCCC1CO |
| InChI | InChI=1S/C11H24N2O3S2/c1-10(9-17-3)12(2)18(15,16)13-7-5-4-6-11(13)8-14/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | MUJOIJYNXTUHAF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |