C8H16ClF3N2O2S — CID 107493022
N-(2-chloroethyl)-N-(diethylsulfamoyl)-2,2,2-trifluoroethanamine (PubChem CID 107493022) has the molecular formula C8H16ClF3N2O2S and a molecular weight of 296.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(diethylsulfamoyl)-2,2,2-trifluoroethanamine.
| Compound Name | N-(2-chloroethyl)-N-(diethylsulfamoyl)-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 107493022 |
| Molecular Formula | C8H16ClF3N2O2S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-(2-chloroethyl)-N-(diethylsulfamoyl)-2,2,2-trifluoroethanamine |
| SMILES | CCN(CC)S(=O)(=O)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C8H16ClF3N2O2S/c1-3-13(4-2)17(15,16)14(6-5-9)7-8(10,11)12/h3-7H2,1-2H3 |
| InChIKey | BNYPMRHNVCGFNB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|