C10H9Cl2F4NO2S — CID 107493038
2-chloro-N-(2-chloroethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 107493038) has the molecular formula C10H9Cl2F4NO2S and a molecular weight of 354.15 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-(2-chloroethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 107493038 |
| Molecular Formula | C10H9Cl2F4NO2S |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2-chloro-N-(2-chloroethyl)-5-fluoro-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cc(F)ccc1Cl)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C10H9Cl2F4NO2S/c11-3-4-17(6-10(14,15)16)20(18,19)9-5-7(13)1-2-8(9)12/h1-2,5H,3-4,6H2 |
| InChIKey | BVBURWJYLVCSQN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|