C9H8ClFN2O2S — CID 75483847
2-chloro-N-(cyanomethyl)-5-fluoro-N-methylbenzenesulfonamide (PubChem CID 75483847) has the molecular formula C9H8ClFN2O2S and a molecular weight of 262.69 g/mol. Its IUPAC name is 2-chloro-N-(cyanomethyl)-5-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 2-chloro-N-(cyanomethyl)-5-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 75483847 |
| Molecular Formula | C9H8ClFN2O2S |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-chloro-N-(cyanomethyl)-5-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CC#N)S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C9H8ClFN2O2S/c1-13(5-4-12)16(14,15)9-6-7(11)2-3-8(9)10/h2-3,6H,5H2,1H3 |
| InChIKey | VAWUMKZNXCIUIU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|