C10H11ClN2O3S — CID 75505544
2-chloro-N-(cyanomethyl)-5-methoxy-N-methylbenzenesulfonamide (PubChem CID 75505544) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 2-chloro-N-(cyanomethyl)-5-methoxy-N-methylbenzenesulfonamide.
| Compound Name | 2-chloro-N-(cyanomethyl)-5-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 75505544 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-chloro-N-(cyanomethyl)-5-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(Cl)c(S(=O)(=O)N(C)CC#N)c1 |
| InChI | InChI=1S/C10H11ClN2O3S/c1-13(6-5-12)17(14,15)10-7-8(16-2)3-4-9(10)11/h3-4,7H,6H2,1-2H3 |
| InChIKey | GZLVWUYZSYGTMP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|