C11H13BrN2O3S — CID 119051555
1-(2-bromo-5-methoxyphenyl)-N-(cyanomethyl)-N-methylmethanesulfonamide (PubChem CID 119051555) has the molecular formula C11H13BrN2O3S and a molecular weight of 333.21 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-N-(cyanomethyl)-N-methylmethanesulfonamide.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-N-(cyanomethyl)-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 119051555 |
| Molecular Formula | C11H13BrN2O3S |
| Molecular Weight | 333.21 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-N-(cyanomethyl)-N-methylmethanesulfonamide |
| SMILES | COc1ccc(Br)c(CS(=O)(=O)N(C)CC#N)c1 |
| InChI | InChI=1S/C11H13BrN2O3S/c1-14(6-5-13)18(15,16)8-9-7-10(17-2)3-4-11(9)12/h3-4,7H,6,8H2,1-2H3 |
| InChIKey | LHOXYSLNGFGARD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|