C10H11FN2O2S — CID 58126992
2-(cyanomethyl)-5-fluoro-N,N-dimethylbenzenesulfonamide (PubChem CID 58126992) has the molecular formula C10H11FN2O2S and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(cyanomethyl)-5-fluoro-N,N-dimethylbenzenesulfonamide.
| Compound Name | 2-(cyanomethyl)-5-fluoro-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 58126992 |
| Molecular Formula | C10H11FN2O2S |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-(cyanomethyl)-5-fluoro-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(F)ccc1CC#N |
| InChI | InChI=1S/C10H11FN2O2S/c1-13(2)16(14,15)10-7-9(11)4-3-8(10)5-6-12/h3-4,7H,5H2,1-2H3 |
| InChIKey | HLQVZHNALYETGB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |