C12H18FNO2S — CID 59389599
5-fluoro-N,N-dimethyl-2-(2-methylpropyl)benzenesulfonamide (PubChem CID 59389599) has the molecular formula C12H18FNO2S and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-2-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 5-fluoro-N,N-dimethyl-2-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59389599 |
| Molecular Formula | C12H18FNO2S |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-2-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)Cc1ccc(F)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C12H18FNO2S/c1-9(2)7-10-5-6-11(13)8-12(10)17(15,16)14(3)4/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | WSQNODGRDNWXNW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |