C4H4ClF6NO3S — CID 139547172
chloro N,N-bis(2,2,2-trifluoroethyl)sulfamate (PubChem CID 139547172) has the molecular formula C4H4ClF6NO3S and a molecular weight of 295.59 g/mol. Its IUPAC name is chloro N,N-bis(2,2,2-trifluoroethyl)sulfamate.
| Compound Name | chloro N,N-bis(2,2,2-trifluoroethyl)sulfamate |
|---|---|
| PubChem CID | 139547172 |
| Molecular Formula | C4H4ClF6NO3S |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | chloro N,N-bis(2,2,2-trifluoroethyl)sulfamate |
| SMILES | O=S(=O)(OCl)N(CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C4H4ClF6NO3S/c5-15-16(13,14)12(1-3(6,7)8)2-4(9,10)11/h1-2H2 |
| InChIKey | WCZSARXLPHHVSB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |