C6H10F3NO3S — CID 155476018
N-(methoxymethyl)-N-(2,2,2-trifluoroethyl)ethenesulfonamide (PubChem CID 155476018) has the molecular formula C6H10F3NO3S and a molecular weight of 233.21 g/mol. Its IUPAC name is N-(methoxymethyl)-N-(2,2,2-trifluoroethyl)ethenesulfonamide.
| Compound Name | N-(methoxymethyl)-N-(2,2,2-trifluoroethyl)ethenesulfonamide |
|---|---|
| PubChem CID | 155476018 |
| Molecular Formula | C6H10F3NO3S |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N-(methoxymethyl)-N-(2,2,2-trifluoroethyl)ethenesulfonamide |
| SMILES | C=CS(=O)(=O)N(COC)CC(F)(F)F |
| InChI | InChI=1S/C6H10F3NO3S/c1-3-14(11,12)10(5-13-2)4-6(7,8)9/h3H,1,4-5H2,2H3 |
| InChIKey | XJLJNRKIJJZFRQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|