C13H19NO4S — CID 138099222
N-benzyl-N-(2,2-dimethoxyethyl)ethenesulfonamide (PubChem CID 138099222) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is N-benzyl-N-(2,2-dimethoxyethyl)ethenesulfonamide.
| Compound Name | N-benzyl-N-(2,2-dimethoxyethyl)ethenesulfonamide |
|---|---|
| PubChem CID | 138099222 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-benzyl-N-(2,2-dimethoxyethyl)ethenesulfonamide |
| SMILES | C=CS(=O)(=O)N(Cc1ccccc1)CC(OC)OC |
| InChI | InChI=1S/C13H19NO4S/c1-4-19(15,16)14(11-13(17-2)18-3)10-12-8-6-5-7-9-12/h4-9,13H,1,10-11H2,2-3H3 |
| InChIKey | GGIWATFBBFPXOJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|