C14H23NO2 — CID 66222971
N-benzyl-N-(2,2-dimethoxyethyl)propan-2-amine (PubChem CID 66222971) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is N-benzyl-N-(2,2-dimethoxyethyl)propan-2-amine.
| Compound Name | N-benzyl-N-(2,2-dimethoxyethyl)propan-2-amine |
|---|---|
| PubChem CID | 66222971 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | N-benzyl-N-(2,2-dimethoxyethyl)propan-2-amine |
| SMILES | COC(CN(Cc1ccccc1)C(C)C)OC |
| InChI | InChI=1S/C14H23NO2/c1-12(2)15(11-14(16-3)17-4)10-13-8-6-5-7-9-13/h5-9,12,14H,10-11H2,1-4H3 |
| InChIKey | FEOVPJQXKAKOSY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|