C6H14F3N3O2S — CID 107493945
2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1,1-trifluoroethane (PubChem CID 107493945) has the molecular formula C6H14F3N3O2S and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1,1-trifluoroethane.
| Compound Name | 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 107493945 |
| Molecular Formula | C6H14F3N3O2S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-[2-aminoethyl(ethylsulfamoyl)amino]-1,1,1-trifluoroethane |
| SMILES | CCNS(=O)(=O)N(CCN)CC(F)(F)F |
| InChI | InChI=1S/C6H14F3N3O2S/c1-2-11-15(13,14)12(4-3-10)5-6(7,8)9/h11H,2-5,10H2,1H3 |
| InChIKey | MLHSOACRZVSJQF-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |