C7H17N3O2S2 — CID 114808251
2-[ethylsulfamoyl(propyl)amino]ethanethioamide (PubChem CID 114808251) has the molecular formula C7H17N3O2S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is 2-[ethylsulfamoyl(propyl)amino]ethanethioamide.
| Compound Name | 2-[ethylsulfamoyl(propyl)amino]ethanethioamide |
|---|---|
| PubChem CID | 114808251 |
| Molecular Formula | C7H17N3O2S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-[ethylsulfamoyl(propyl)amino]ethanethioamide |
| SMILES | CCCN(CC(N)=S)S(=O)(=O)NCC |
| InChI | InChI=1S/C7H17N3O2S2/c1-3-5-10(6-7(8)13)14(11,12)9-4-2/h9H,3-6H2,1-2H3,(H2,8,13) |
| InChIKey | QTXSNJFOEIWZGV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|