C11H13Cl2FN2O2S2 — CID 103088140
2-[(2,4-dichloro-3-fluorophenyl)sulfonyl-propylamino]ethanethioamide (PubChem CID 103088140) has the molecular formula C11H13Cl2FN2O2S2 and a molecular weight of 359.28 g/mol. Its IUPAC name is 2-[(2,4-dichloro-3-fluorophenyl)sulfonyl-propylamino]ethanethioamide.
| Compound Name | 2-[(2,4-dichloro-3-fluorophenyl)sulfonyl-propylamino]ethanethioamide |
|---|---|
| PubChem CID | 103088140 |
| Molecular Formula | C11H13Cl2FN2O2S2 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-[(2,4-dichloro-3-fluorophenyl)sulfonyl-propylamino]ethanethioamide |
| SMILES | CCCN(CC(N)=S)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H13Cl2FN2O2S2/c1-2-5-16(6-9(15)19)20(17,18)8-4-3-7(12)11(14)10(8)13/h3-4H,2,5-6H2,1H3,(H2,15,19) |
| InChIKey | DKUKMKKISXSKHC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|