C11H10Cl2FNO4S — CID 103087535
2-[cyclopropyl-(2,4-dichloro-3-fluorophenyl)sulfonylamino]acetic acid (PubChem CID 103087535) has the molecular formula C11H10Cl2FNO4S and a molecular weight of 342.18 g/mol. Its IUPAC name is 2-[cyclopropyl-(2,4-dichloro-3-fluorophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[cyclopropyl-(2,4-dichloro-3-fluorophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 103087535 |
| Molecular Formula | C11H10Cl2FNO4S |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | 2-[cyclopropyl-(2,4-dichloro-3-fluorophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CN(C1CC1)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C11H10Cl2FNO4S/c12-7-3-4-8(10(13)11(7)14)20(18,19)15(5-9(16)17)6-1-2-6/h3-4,6H,1-2,5H2,(H,16,17) |
| InChIKey | UITKDJJCEVGHAZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|