C13H15Cl2FN2O2S — CID 103088037
2,4-dichloro-N-(2-cyanoethyl)-3-fluoro-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 103088037) has the molecular formula C13H15Cl2FN2O2S and a molecular weight of 353.25 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-cyanoethyl)-3-fluoro-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(2-cyanoethyl)-3-fluoro-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103088037 |
| Molecular Formula | C13H15Cl2FN2O2S |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2,4-dichloro-N-(2-cyanoethyl)-3-fluoro-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CCC#N)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C13H15Cl2FN2O2S/c1-9(2)8-18(7-3-6-17)21(19,20)11-5-4-10(14)13(16)12(11)15/h4-5,9H,3,7-8H2,1-2H3 |
| InChIKey | PFRFZBJELNAUJR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|