C10H11Cl3FNO2S — CID 114230859
2,4-dichloro-N-(3-chloropropyl)-3-fluoro-N-methylbenzenesulfonamide (PubChem CID 114230859) has the molecular formula C10H11Cl3FNO2S and a molecular weight of 334.63 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-chloropropyl)-3-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 2,4-dichloro-N-(3-chloropropyl)-3-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114230859 |
| Molecular Formula | C10H11Cl3FNO2S |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2,4-dichloro-N-(3-chloropropyl)-3-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(CCCCl)S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H11Cl3FNO2S/c1-15(6-2-5-11)18(16,17)8-4-3-7(12)10(14)9(8)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | PAWSNXYYCCCGJT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|