C8H18F3N3O2S — CID 114812748
1-[2-aminoethyl(2,2,2-trifluoroethylsulfamoyl)amino]butane (PubChem CID 114812748) has the molecular formula C8H18F3N3O2S and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[2-aminoethyl(2,2,2-trifluoroethylsulfamoyl)amino]butane.
| Compound Name | 1-[2-aminoethyl(2,2,2-trifluoroethylsulfamoyl)amino]butane |
|---|---|
| PubChem CID | 114812748 |
| Molecular Formula | C8H18F3N3O2S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[2-aminoethyl(2,2,2-trifluoroethylsulfamoyl)amino]butane |
| SMILES | CCCCN(CCN)S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H18F3N3O2S/c1-2-3-5-14(6-4-12)17(15,16)13-7-8(9,10)11/h13H,2-7,12H2,1H3 |
| InChIKey | VDSYBNUJQNEVAI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |