C9H18F3NO2S — CID 89281546
N-butyl-2,2,2-trifluoro-N-propylethanesulfonamide (PubChem CID 89281546) has the molecular formula C9H18F3NO2S and a molecular weight of 261.31 g/mol. Its IUPAC name is N-butyl-2,2,2-trifluoro-N-propylethanesulfonamide.
| Compound Name | N-butyl-2,2,2-trifluoro-N-propylethanesulfonamide |
|---|---|
| PubChem CID | 89281546 |
| Molecular Formula | C9H18F3NO2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-butyl-2,2,2-trifluoro-N-propylethanesulfonamide |
| SMILES | CCCCN(CCC)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2S/c1-3-5-7-13(6-4-2)16(14,15)8-9(10,11)12/h3-8H2,1-2H3 |
| InChIKey | WHNAFYXMIQUBLV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |