C14H26F5NO2S — CID 147263516
N-butyl-N-(3,4-dimethylpentyl)-2,2,3,3,3-pentafluoropropane-1-sulfonamide (PubChem CID 147263516) has the molecular formula C14H26F5NO2S and a molecular weight of 367.42 g/mol. Its IUPAC name is N-butyl-N-(3,4-dimethylpentyl)-2,2,3,3,3-pentafluoropropane-1-sulfonamide.
| Compound Name | N-butyl-N-(3,4-dimethylpentyl)-2,2,3,3,3-pentafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 147263516 |
| Molecular Formula | C14H26F5NO2S |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-butyl-N-(3,4-dimethylpentyl)-2,2,3,3,3-pentafluoropropane-1-sulfonamide |
| SMILES | CCCCN(CCC(C)C(C)C)S(=O)(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H26F5NO2S/c1-5-6-8-20(9-7-12(4)11(2)3)23(21,22)10-13(15,16)14(17,18)19/h11-12H,5-10H2,1-4H3 |
| InChIKey | CPAMLAWNUKDCLU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|